C15H19NO — CID 11817064
4-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline (PubChem CID 11817064) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 4-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 11817064 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 4-prop-2-enoxy-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCOc1ccc(N(CC=C)CC=C)cc1 |
| InChI | InChI=1S/C15H19NO/c1-4-11-16(12-5-2)14-7-9-15(10-8-14)17-13-6-3/h4-10H,1-3,11-13H2 |
| InChIKey | XKJNYVBLBQOJLM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|