C29H38N2 — CID 139763507
4-[3-[4-[bis(prop-2-enyl)amino]phenyl]pentan-3-yl]-N,N-bis(prop-2-enyl)aniline (PubChem CID 139763507) has the molecular formula C29H38N2 and a molecular weight of 414.64 g/mol. Its IUPAC name is 4-[3-[4-[bis(prop-2-enyl)amino]phenyl]pentan-3-yl]-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 4-[3-[4-[bis(prop-2-enyl)amino]phenyl]pentan-3-yl]-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 139763507 |
| Molecular Formula | C29H38N2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 4-[3-[4-[bis(prop-2-enyl)amino]phenyl]pentan-3-yl]-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc(C(CC)(CC)c2ccc(N(CC=C)CC=C)cc2)cc1 |
| InChI | InChI=1S/C29H38N2/c1-7-21-30(22-8-2)27-17-13-25(14-18-27)29(11-5,12-6)26-15-19-28(20-16-26)31(23-9-3)24-10-4/h7-10,13-20H,1-4,11-12,21-24H2,5-6H3 |
| InChIKey | ZOAOYAWZRCIRQH-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|