C12H14N2 — CID 78958833
4-[ethyl(prop-2-enyl)amino]benzonitrile (PubChem CID 78958833) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-[ethyl(prop-2-enyl)amino]benzonitrile.
| Compound Name | 4-[ethyl(prop-2-enyl)amino]benzonitrile |
|---|---|
| PubChem CID | 78958833 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-[ethyl(prop-2-enyl)amino]benzonitrile |
| SMILES | C=CCN(CC)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H14N2/c1-3-9-14(4-2)12-7-5-11(10-13)6-8-12/h3,5-8H,1,4,9H2,2H3 |
| InChIKey | XXQDOEDQCRBICY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|