C11H11Cl2N3O — CID 91071262
2,4-dichloro-6-phenoxy-1,3,5-triazine;ethane (PubChem CID 91071262) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.14 g/mol. Its IUPAC name is 2,4-dichloro-6-phenoxy-1,3,5-triazine;ethane.
| Compound Name | 2,4-dichloro-6-phenoxy-1,3,5-triazine;ethane |
|---|---|
| PubChem CID | 91071262 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2,4-dichloro-6-phenoxy-1,3,5-triazine;ethane |
| SMILES | CC.Clc1nc(Cl)nc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C9H5Cl2N3O.C2H6/c10-7-12-8(11)14-9(13-7)15-6-4-2-1-3-5-6;1-2/h1-5H;1-2H3 |
| InChIKey | RBJUFMGJGKVKQI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |