About 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine
2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine (PubChem CID 54201901) has the molecular formula C10H7Cl2N3O2
and a molecular weight of 272.09 g/mol. Its IUPAC name is 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine |
| PubChem CID | 54201901 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine |
| SMILES | COc1ccccc1Oc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H7Cl2N3O2/c1-16-6-4-2-3-5-7(6)17-10-14-8(11)13-9(12)15-10/h2-5H,1H3 |
| InChIKey | PPVNXUDHRSRXIO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine?
The IUPAC name of 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine (CID 54201901) is 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine.
What is the SMILES notation for 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine?
The canonical SMILES for 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine is COc1ccccc1Oc1nc(Cl)nc(Cl)n1.
What is the InChIKey of 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine?
The InChIKey is PPVNXUDHRSRXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2N3O2/c1-16-6-4-2-3-5-7(6)17-10-14-8(11)13-9(12)15-10/h2-5H,1H3.
What are the key properties of 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine?
2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine has a molecular weight of 272.09 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-(2-methoxyphenoxy)-1,3,5-triazine is sourced from PubChem (CID 54201901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).