C11H12N4O3 — CID 80869201
4-methoxy-6-(2-methoxyphenoxy)-1,3,5-triazin-2-amine (PubChem CID 80869201) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is 4-methoxy-6-(2-methoxyphenoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-(2-methoxyphenoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80869201 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-methoxy-6-(2-methoxyphenoxy)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(Oc2ccccc2OC)n1 |
| InChI | InChI=1S/C11H12N4O3/c1-16-7-5-3-4-6-8(7)18-11-14-9(12)13-10(15-11)17-2/h3-6H,1-2H3,(H2,12,13,14,15) |
| InChIKey | MTASHHJXLYMJKC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |