C11H11N5O5 — CID 103202380
4-methoxy-6-(4-methoxy-3-nitrophenoxy)-1,3,5-triazin-2-amine (PubChem CID 103202380) has the molecular formula C11H11N5O5 and a molecular weight of 293.24 g/mol. Its IUPAC name is 4-methoxy-6-(4-methoxy-3-nitrophenoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-(4-methoxy-3-nitrophenoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103202380 |
| Molecular Formula | C11H11N5O5 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-methoxy-6-(4-methoxy-3-nitrophenoxy)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(Oc2ccc(OC)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H11N5O5/c1-19-8-4-3-6(5-7(8)16(17)18)21-11-14-9(12)13-10(15-11)20-2/h3-5H,1-2H3,(H2,12,13,14,15) |
| InChIKey | RMPKNMSNRNPMLE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|