C11H9ClN4O5 — CID 4649042
2-(3-chloro-4-nitrophenoxy)-4,6-dimethoxy-1,3,5-triazine (PubChem CID 4649042) has the molecular formula C11H9ClN4O5 and a molecular weight of 312.67 g/mol. Its IUPAC name is 2-(3-chloro-4-nitrophenoxy)-4,6-dimethoxy-1,3,5-triazine.
| Compound Name | 2-(3-chloro-4-nitrophenoxy)-4,6-dimethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 4649042 |
| Molecular Formula | C11H9ClN4O5 |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-(3-chloro-4-nitrophenoxy)-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(Oc2ccc([N+](=O)[O-])c(Cl)c2)n1 |
| InChI | InChI=1S/C11H9ClN4O5/c1-19-9-13-10(20-2)15-11(14-9)21-6-3-4-8(16(17)18)7(12)5-6/h3-5H,1-2H3 |
| InChIKey | ZRSTTYFRZMZZMS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 109.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|