C13H12ClN3O4 — CID 103201617
2-chloro-3-(4-methoxy-3-nitrophenoxy)-5,6-dimethylpyrazine (PubChem CID 103201617) has the molecular formula C13H12ClN3O4 and a molecular weight of 309.71 g/mol. Its IUPAC name is 2-chloro-3-(4-methoxy-3-nitrophenoxy)-5,6-dimethylpyrazine.
| Compound Name | 2-chloro-3-(4-methoxy-3-nitrophenoxy)-5,6-dimethylpyrazine |
|---|---|
| PubChem CID | 103201617 |
| Molecular Formula | C13H12ClN3O4 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-chloro-3-(4-methoxy-3-nitrophenoxy)-5,6-dimethylpyrazine |
| SMILES | COc1ccc(Oc2nc(C)c(C)nc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12ClN3O4/c1-7-8(2)16-13(12(14)15-7)21-9-4-5-11(20-3)10(6-9)17(18)19/h4-6H,1-3H3 |
| InChIKey | YJNLANTZCDWYAH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|