C9H6ClN3O4S — CID 60726071
3-chloro-4-(4-methoxy-2-nitrophenoxy)-1,2,5-thiadiazole (PubChem CID 60726071) has the molecular formula C9H6ClN3O4S and a molecular weight of 287.68 g/mol. Its IUPAC name is 3-chloro-4-(4-methoxy-2-nitrophenoxy)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(4-methoxy-2-nitrophenoxy)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 60726071 |
| Molecular Formula | C9H6ClN3O4S |
| Molecular Weight | 287.68 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 3-chloro-4-(4-methoxy-2-nitrophenoxy)-1,2,5-thiadiazole |
| SMILES | COc1ccc(Oc2nsnc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H6ClN3O4S/c1-16-5-2-3-7(6(4-5)13(14)15)17-9-8(10)11-18-12-9/h2-4H,1H3 |
| InChIKey | GMBSBPQGGJALNM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|