C11H8Cl2N2O4S — CID 80687781
4-chloro-5-(chloromethyl)-2-(4-methoxy-2-nitrophenoxy)-1,3-thiazole (PubChem CID 80687781) has the molecular formula C11H8Cl2N2O4S and a molecular weight of 335.17 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-(4-methoxy-2-nitrophenoxy)-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-(4-methoxy-2-nitrophenoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 80687781 |
| Molecular Formula | C11H8Cl2N2O4S |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-(4-methoxy-2-nitrophenoxy)-1,3-thiazole |
| SMILES | COc1ccc(Oc2nc(Cl)c(CCl)s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H8Cl2N2O4S/c1-18-6-2-3-8(7(4-6)15(16)17)19-11-14-10(13)9(5-12)20-11/h2-4H,5H2,1H3 |
| InChIKey | IJVKRRHWSKLSBH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|