C10H4BrCl2FN2O3S — CID 103483415
2-(4-bromo-5-fluoro-2-nitrophenoxy)-4-chloro-5-(chloromethyl)-1,3-thiazole (PubChem CID 103483415) has the molecular formula C10H4BrCl2FN2O3S and a molecular weight of 402.03 g/mol. Its IUPAC name is 2-(4-bromo-5-fluoro-2-nitrophenoxy)-4-chloro-5-(chloromethyl)-1,3-thiazole.
| Compound Name | 2-(4-bromo-5-fluoro-2-nitrophenoxy)-4-chloro-5-(chloromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 103483415 |
| Molecular Formula | C10H4BrCl2FN2O3S |
| Molecular Weight | 402.03 g/mol |
| Exact Mass | 399.85 |
| IUPAC Name | 2-(4-bromo-5-fluoro-2-nitrophenoxy)-4-chloro-5-(chloromethyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cc(Br)c(F)cc1Oc1nc(Cl)c(CCl)s1 |
| InChI | InChI=1S/C10H4BrCl2FN2O3S/c11-4-1-6(16(17)18)7(2-5(4)14)19-10-15-9(13)8(3-12)20-10/h1-2H,3H2 |
| InChIKey | MYTMKUFSVVXZPH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.03 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|