C10H4BrClN2O4S — CID 80688285
2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carbaldehyde (PubChem CID 80688285) has the molecular formula C10H4BrClN2O4S and a molecular weight of 363.58 g/mol. Its IUPAC name is 2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80688285 |
| Molecular Formula | C10H4BrClN2O4S |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 361.88 |
| IUPAC Name | 2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(Oc2ccc(Br)cc2[N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C10H4BrClN2O4S/c11-5-1-2-7(6(3-5)14(16)17)18-10-13-9(12)8(4-15)19-10/h1-4H |
| InChIKey | IFSZAZMPXPMKEL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|