C10H4BrClN2O5S — CID 80692092
2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid (PubChem CID 80692092) has the molecular formula C10H4BrClN2O5S and a molecular weight of 379.58 g/mol. Its IUPAC name is 2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80692092 |
| Molecular Formula | C10H4BrClN2O5S |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 2-(4-bromo-2-nitrophenoxy)-4-chloro-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(Oc2ccc(Br)cc2[N+](=O)[O-])nc1Cl |
| InChI | InChI=1S/C10H4BrClN2O5S/c11-4-1-2-6(5(3-4)14(17)18)19-10-13-8(12)7(20-10)9(15)16/h1-3H,(H,15,16) |
| InChIKey | HADGCPFOIBSLMQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|