C14H11BrClNO3 — CID 63463836
2-(4-bromo-2-nitrophenoxy)-5-chloro-1,3-dimethylbenzene (PubChem CID 63463836) has the molecular formula C14H11BrClNO3 and a molecular weight of 356.60 g/mol. Its IUPAC name is 2-(4-bromo-2-nitrophenoxy)-5-chloro-1,3-dimethylbenzene.
| Compound Name | 2-(4-bromo-2-nitrophenoxy)-5-chloro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 63463836 |
| Molecular Formula | C14H11BrClNO3 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 2-(4-bromo-2-nitrophenoxy)-5-chloro-1,3-dimethylbenzene |
| SMILES | Cc1cc(Cl)cc(C)c1Oc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11BrClNO3/c1-8-5-11(16)6-9(2)14(8)20-13-4-3-10(15)7-12(13)17(18)19/h3-7H,1-2H3 |
| InChIKey | CXUFEBBBWRWSDE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|