C14H11Br2NO3 — CID 107724090
2-bromo-5-(4-bromo-2-nitrophenoxy)-1,3-dimethylbenzene (PubChem CID 107724090) has the molecular formula C14H11Br2NO3 and a molecular weight of 401.05 g/mol. Its IUPAC name is 2-bromo-5-(4-bromo-2-nitrophenoxy)-1,3-dimethylbenzene.
| Compound Name | 2-bromo-5-(4-bromo-2-nitrophenoxy)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 107724090 |
| Molecular Formula | C14H11Br2NO3 |
| Molecular Weight | 401.05 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | 2-bromo-5-(4-bromo-2-nitrophenoxy)-1,3-dimethylbenzene |
| SMILES | Cc1cc(Oc2ccc(Br)cc2[N+](=O)[O-])cc(C)c1Br |
| InChI | InChI=1S/C14H11Br2NO3/c1-8-5-11(6-9(2)14(8)16)20-13-4-3-10(15)7-12(13)17(18)19/h3-7H,1-2H3 |
| InChIKey | SRNHSQDONXKWLK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|