C11H8Cl3NOS — CID 80687597
4-chloro-5-(chloromethyl)-2-(4-chloro-2-methylphenoxy)-1,3-thiazole (PubChem CID 80687597) has the molecular formula C11H8Cl3NOS and a molecular weight of 308.62 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-(4-chloro-2-methylphenoxy)-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-(4-chloro-2-methylphenoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 80687597 |
| Molecular Formula | C11H8Cl3NOS |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-(4-chloro-2-methylphenoxy)-1,3-thiazole |
| SMILES | Cc1cc(Cl)ccc1Oc1nc(Cl)c(CCl)s1 |
| InChI | InChI=1S/C11H8Cl3NOS/c1-6-4-7(13)2-3-8(6)16-11-15-10(14)9(5-12)17-11/h2-4H,5H2,1H3 |
| InChIKey | FORALUZJJHIYNG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|