C11H10BrN5O4 — CID 80870756
4-(4-bromo-2-methyl-6-nitrophenoxy)-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 80870756) has the molecular formula C11H10BrN5O4 and a molecular weight of 356.14 g/mol. Its IUPAC name is 4-(4-bromo-2-methyl-6-nitrophenoxy)-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-bromo-2-methyl-6-nitrophenoxy)-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80870756 |
| Molecular Formula | C11H10BrN5O4 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 4-(4-bromo-2-methyl-6-nitrophenoxy)-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(Oc2c(C)cc(Br)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H10BrN5O4/c1-5-3-6(12)4-7(17(18)19)8(5)21-11-15-9(13)14-10(16-11)20-2/h3-4H,1-2H3,(H2,13,14,15,16) |
| InChIKey | ZRJQOZMFPBPNBW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|