C13H11BrClN3O3 — CID 79842513
4-(4-bromo-2-methyl-6-nitrophenoxy)-6-chloro-2,5-dimethylpyrimidine (PubChem CID 79842513) has the molecular formula C13H11BrClN3O3 and a molecular weight of 372.61 g/mol. Its IUPAC name is 4-(4-bromo-2-methyl-6-nitrophenoxy)-6-chloro-2,5-dimethylpyrimidine.
| Compound Name | 4-(4-bromo-2-methyl-6-nitrophenoxy)-6-chloro-2,5-dimethylpyrimidine |
|---|---|
| PubChem CID | 79842513 |
| Molecular Formula | C13H11BrClN3O3 |
| Molecular Weight | 372.61 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 4-(4-bromo-2-methyl-6-nitrophenoxy)-6-chloro-2,5-dimethylpyrimidine |
| SMILES | Cc1nc(Cl)c(C)c(Oc2c(C)cc(Br)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H11BrClN3O3/c1-6-4-9(14)5-10(18(19)20)11(6)21-13-7(2)12(15)16-8(3)17-13/h4-5H,1-3H3 |
| InChIKey | WYMQQSVTZJLMQM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|