C13H9BrCl2N2O3 — CID 165114514
3-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-2,4-dichloropyridine (PubChem CID 165114514) has the molecular formula C13H9BrCl2N2O3 and a molecular weight of 392.04 g/mol. Its IUPAC name is 3-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-2,4-dichloropyridine.
| Compound Name | 3-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-2,4-dichloropyridine |
|---|---|
| PubChem CID | 165114514 |
| Molecular Formula | C13H9BrCl2N2O3 |
| Molecular Weight | 392.04 g/mol |
| Exact Mass | 389.92 |
| IUPAC Name | 3-[(4-bromo-2-methyl-6-nitrophenoxy)methyl]-2,4-dichloropyridine |
| SMILES | Cc1cc(Br)cc([N+](=O)[O-])c1OCc1c(Cl)ccnc1Cl |
| InChI | InChI=1S/C13H9BrCl2N2O3/c1-7-4-8(14)5-11(18(19)20)12(7)21-6-9-10(15)2-3-17-13(9)16/h2-5H,6H2,1H3 |
| InChIKey | ULLQOVGENSIUIE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.04 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|