About [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol
[4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol (PubChem CID 80870447) has the molecular formula C11H12N4O3
and a molecular weight of 248.24 g/mol. Its IUPAC name is [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol |
| PubChem CID | 80870447 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol |
| SMILES | COc1nc(N)nc(Oc2ccc(CO)cc2)n1 |
| InChI | InChI=1S/C11H12N4O3/c1-17-10-13-9(12)14-11(15-10)18-8-4-2-7(6-16)3-5-8/h2-5,16H,6H2,1H3,(H2,12,13,14,15) |
| InChIKey | FMHJUNCTBZDGQX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol?
The IUPAC name of [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol (CID 80870447) is [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol.
What is the SMILES notation for [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol?
The canonical SMILES for [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol is COc1nc(N)nc(Oc2ccc(CO)cc2)n1.
What is the InChIKey of [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol?
The InChIKey is FMHJUNCTBZDGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3/c1-17-10-13-9(12)14-11(15-10)18-8-4-2-7(6-16)3-5-8/h2-5,16H,6H2,1H3,(H2,12,13,14,15).
What are the key properties of [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol?
[4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol has a molecular weight of 248.24 g/mol, XLogP of 0.75, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]phenyl]methanol is sourced from PubChem (CID 80870447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).