C11H11N5O3 — CID 80881678
4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]benzamide (PubChem CID 80881678) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]benzamide.
| Compound Name | 4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]benzamide |
|---|---|
| PubChem CID | 80881678 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-[(4-amino-6-methoxy-1,3,5-triazin-2-yl)oxy]benzamide |
| SMILES | COc1nc(N)nc(Oc2ccc(C(N)=O)cc2)n1 |
| InChI | InChI=1S/C11H11N5O3/c1-18-10-14-9(13)15-11(16-10)19-7-4-2-6(3-5-7)8(12)17/h2-5H,1H3,(H2,12,17)(H2,13,14,15,16) |
| InChIKey | CKEAECIDNKAUDC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |