C10H7Cl2N3OS — CID 62868242
2,4-dichloro-6-(2-methoxyphenyl)sulfanyl-1,3,5-triazine (PubChem CID 62868242) has the molecular formula C10H7Cl2N3OS and a molecular weight of 288.16 g/mol. Its IUPAC name is 2,4-dichloro-6-(2-methoxyphenyl)sulfanyl-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(2-methoxyphenyl)sulfanyl-1,3,5-triazine |
|---|---|
| PubChem CID | 62868242 |
| Molecular Formula | C10H7Cl2N3OS |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2,4-dichloro-6-(2-methoxyphenyl)sulfanyl-1,3,5-triazine |
| SMILES | COc1ccccc1Sc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H7Cl2N3OS/c1-16-6-4-2-3-5-7(6)17-10-14-8(11)13-9(12)15-10/h2-5H,1H3 |
| InChIKey | PEILAACZGGTNBB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |