C17H11Cl3N2O2 — CID 156768151
4,6-dichloro-2-(4-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidine (PubChem CID 156768151) has the molecular formula C17H11Cl3N2O2 and a molecular weight of 381.65 g/mol. Its IUPAC name is 4,6-dichloro-2-(4-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidine.
| Compound Name | 4,6-dichloro-2-(4-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidine |
|---|---|
| PubChem CID | 156768151 |
| Molecular Formula | C17H11Cl3N2O2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | 4,6-dichloro-2-(4-chlorophenyl)-5-(2-methoxyphenoxy)pyrimidine |
| SMILES | COc1ccccc1Oc1c(Cl)nc(-c2ccc(Cl)cc2)nc1Cl |
| InChI | InChI=1S/C17H11Cl3N2O2/c1-23-12-4-2-3-5-13(12)24-14-15(19)21-17(22-16(14)20)10-6-8-11(18)9-7-10/h2-9H,1H3 |
| InChIKey | DBBCUGFARXCSQY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |