C11H6Cl2FIN2O — CID 107922643
4,6-dichloro-2-(4-fluoro-3-methoxyphenyl)-5-iodopyrimidine (PubChem CID 107922643) has the molecular formula C11H6Cl2FIN2O and a molecular weight of 398.99 g/mol. Its IUPAC name is 4,6-dichloro-2-(4-fluoro-3-methoxyphenyl)-5-iodopyrimidine.
| Compound Name | 4,6-dichloro-2-(4-fluoro-3-methoxyphenyl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 107922643 |
| Molecular Formula | C11H6Cl2FIN2O |
| Molecular Weight | 398.99 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | 4,6-dichloro-2-(4-fluoro-3-methoxyphenyl)-5-iodopyrimidine |
| SMILES | COc1cc(-c2nc(Cl)c(I)c(Cl)n2)ccc1F |
| InChI | InChI=1S/C11H6Cl2FIN2O/c1-18-7-4-5(2-3-6(7)14)11-16-9(12)8(15)10(13)17-11/h2-4H,1H3 |
| InChIKey | VIPFVQJDUGDWNQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.99 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|