C14H14ClIN2O3 — CID 66294483
4-chloro-2-(3,4-dimethoxyphenyl)-5-iodo-6-(methoxymethyl)pyrimidine (PubChem CID 66294483) has the molecular formula C14H14ClIN2O3 and a molecular weight of 420.63 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dimethoxyphenyl)-5-iodo-6-(methoxymethyl)pyrimidine.
| Compound Name | 4-chloro-2-(3,4-dimethoxyphenyl)-5-iodo-6-(methoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 66294483 |
| Molecular Formula | C14H14ClIN2O3 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 4-chloro-2-(3,4-dimethoxyphenyl)-5-iodo-6-(methoxymethyl)pyrimidine |
| SMILES | COCc1nc(-c2ccc(OC)c(OC)c2)nc(Cl)c1I |
| InChI | InChI=1S/C14H14ClIN2O3/c1-19-7-9-12(16)13(15)18-14(17-9)8-4-5-10(20-2)11(6-8)21-3/h4-6H,7H2,1-3H3 |
| InChIKey | DAXZVFWPQRGEES-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|