C14H14ClIN2O — CID 66313448
4-chloro-2-(3,5-dimethylphenyl)-5-iodo-6-(methoxymethyl)pyrimidine (PubChem CID 66313448) has the molecular formula C14H14ClIN2O and a molecular weight of 388.64 g/mol. Its IUPAC name is 4-chloro-2-(3,5-dimethylphenyl)-5-iodo-6-(methoxymethyl)pyrimidine.
| Compound Name | 4-chloro-2-(3,5-dimethylphenyl)-5-iodo-6-(methoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 66313448 |
| Molecular Formula | C14H14ClIN2O |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 4-chloro-2-(3,5-dimethylphenyl)-5-iodo-6-(methoxymethyl)pyrimidine |
| SMILES | COCc1nc(-c2cc(C)cc(C)c2)nc(Cl)c1I |
| InChI | InChI=1S/C14H14ClIN2O/c1-8-4-9(2)6-10(5-8)14-17-11(7-19-3)12(16)13(15)18-14/h4-6H,7H2,1-3H3 |
| InChIKey | ONUKIOOBMNBYKY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|