C12H7ClF3IN2O — CID 66294897
4-chloro-5-iodo-6-(methoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine (PubChem CID 66294897) has the molecular formula C12H7ClF3IN2O and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-chloro-5-iodo-6-(methoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine.
| Compound Name | 4-chloro-5-iodo-6-(methoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 66294897 |
| Molecular Formula | C12H7ClF3IN2O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 4-chloro-5-iodo-6-(methoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine |
| SMILES | COCc1nc(-c2cc(F)c(F)c(F)c2)nc(Cl)c1I |
| InChI | InChI=1S/C12H7ClF3IN2O/c1-20-4-8-10(17)11(13)19-12(18-8)5-2-6(14)9(16)7(15)3-5/h2-3H,4H2,1H3 |
| InChIKey | AJIKKWFLZGGQBL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|