C10H8FIN2O2 — CID 81284166
5-(4-fluoro-3-methoxyphenyl)-4-iodo-1,2-oxazol-3-amine (PubChem CID 81284166) has the molecular formula C10H8FIN2O2 and a molecular weight of 334.09 g/mol. Its IUPAC name is 5-(4-fluoro-3-methoxyphenyl)-4-iodo-1,2-oxazol-3-amine.
| Compound Name | 5-(4-fluoro-3-methoxyphenyl)-4-iodo-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 81284166 |
| Molecular Formula | C10H8FIN2O2 |
| Molecular Weight | 334.09 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5-(4-fluoro-3-methoxyphenyl)-4-iodo-1,2-oxazol-3-amine |
| SMILES | COc1cc(-c2onc(N)c2I)ccc1F |
| InChI | InChI=1S/C10H8FIN2O2/c1-15-7-4-5(2-3-6(7)11)9-8(12)10(13)14-16-9/h2-4H,1H3,(H2,13,14) |
| InChIKey | NMKJRMLZUIGZAT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|