C13H8FIN2O — CID 114088309
5-(4-fluoronaphthalen-1-yl)-4-iodo-1,2-oxazol-3-amine (PubChem CID 114088309) has the molecular formula C13H8FIN2O and a molecular weight of 354.12 g/mol. Its IUPAC name is 5-(4-fluoronaphthalen-1-yl)-4-iodo-1,2-oxazol-3-amine.
| Compound Name | 5-(4-fluoronaphthalen-1-yl)-4-iodo-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 114088309 |
| Molecular Formula | C13H8FIN2O |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 5-(4-fluoronaphthalen-1-yl)-4-iodo-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(F)c3ccccc23)c1I |
| InChI | InChI=1S/C13H8FIN2O/c14-10-6-5-9(7-3-1-2-4-8(7)10)12-11(15)13(16)17-18-12/h1-6H,(H2,16,17) |
| InChIKey | BKFKFXXTZZBZFF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|