C7H4ClIN2O2 — CID 106690691
5-(2-chlorofuran-3-yl)-4-iodo-1,2-oxazol-3-amine (PubChem CID 106690691) has the molecular formula C7H4ClIN2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 5-(2-chlorofuran-3-yl)-4-iodo-1,2-oxazol-3-amine.
| Compound Name | 5-(2-chlorofuran-3-yl)-4-iodo-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 106690691 |
| Molecular Formula | C7H4ClIN2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 309.90 |
| IUPAC Name | 5-(2-chlorofuran-3-yl)-4-iodo-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccoc2Cl)c1I |
| InChI | InChI=1S/C7H4ClIN2O2/c8-6-3(1-2-12-6)5-4(9)7(10)11-13-5/h1-2H,(H2,10,11) |
| InChIKey | FCOOMWBIFIVBNO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|