C9H10N2O2 — CID 66200401
4-methyl-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine (PubChem CID 66200401) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methyl-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine.
| Compound Name | 4-methyl-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200401 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-methyl-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1occc1-c1onc(N)c1C |
| InChI | InChI=1S/C9H10N2O2/c1-5-8(13-11-9(5)10)7-3-4-12-6(7)2/h3-4H,1-2H3,(H2,10,11) |
| InChIKey | ATGOXWYGCKGZPE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |