C14H11FN2O2 — CID 66198177
4-(3-fluorophenyl)-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine (PubChem CID 66198177) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine.
| Compound Name | 4-(3-fluorophenyl)-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198177 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-(3-fluorophenyl)-5-(2-methylfuran-3-yl)-1,2-oxazol-3-amine |
| SMILES | Cc1occc1-c1onc(N)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C14H11FN2O2/c1-8-11(5-6-18-8)13-12(14(16)17-19-13)9-3-2-4-10(15)7-9/h2-7H,1H3,(H2,16,17) |
| InChIKey | VBCPPAPPTSQSSB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |