C12H10N2O2S — CID 66198188
5-(2-methylfuran-3-yl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66198188) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 5-(2-methylfuran-3-yl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(2-methylfuran-3-yl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198188 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 5-(2-methylfuran-3-yl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | Cc1occc1-c1onc(N)c1-c1cccs1 |
| InChI | InChI=1S/C12H10N2O2S/c1-7-8(4-5-15-7)11-10(12(13)14-16-11)9-3-2-6-17-9/h2-6H,1H3,(H2,13,14) |
| InChIKey | WUBJZQSZKOVTMA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |