About 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine
5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66198588) has the molecular formula C14H11N3O3S
and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| PubChem CID | 66198588 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | Cc1ccc([N+](=O)[O-])c(-c2onc(N)c2-c2cccs2)c1 |
| InChI | InChI=1S/C14H11N3O3S/c1-8-4-5-10(17(18)19)9(7-8)13-12(14(15)16-20-13)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16) |
| InChIKey | JSKDGLDHEFUUDD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine?
The IUPAC name of 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (CID 66198588) is 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine?
The canonical SMILES for 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine is Cc1ccc([N+](=O)[O-])c(-c2onc(N)c2-c2cccs2)c1.
What is the InChIKey of 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine?
The InChIKey is JSKDGLDHEFUUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O3S/c1-8-4-5-10(17(18)19)9(7-8)13-12(14(15)16-20-13)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16).
What are the key properties of 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine?
5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine has a molecular weight of 301.33 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methyl-2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine is sourced from PubChem (CID 66198588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).