C15H14N2O3S — CID 66200393
5-(3,5-dimethoxyphenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66200393) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(3,5-dimethoxyphenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200393 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | COc1cc(OC)cc(-c2onc(N)c2-c2cccs2)c1 |
| InChI | InChI=1S/C15H14N2O3S/c1-18-10-6-9(7-11(8-10)19-2)14-13(15(16)17-20-14)12-4-3-5-21-12/h3-8H,1-2H3,(H2,16,17) |
| InChIKey | UVMUOENJAXLGNY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |