C13H8Cl2N2OS — CID 66200386
5-(3,4-dichlorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66200386) has the molecular formula C13H8Cl2N2OS and a molecular weight of 311.19 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(3,4-dichlorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66200386 |
| Molecular Formula | C13H8Cl2N2OS |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccc(Cl)c(Cl)c2)c1-c1cccs1 |
| InChI | InChI=1S/C13H8Cl2N2OS/c14-8-4-3-7(6-9(8)15)12-11(13(16)17-18-12)10-2-1-5-19-10/h1-6H,(H2,16,17) |
| InChIKey | GMMSNSWGTBPSBD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |