C13H8F2N2OS — CID 66199984
5-(2,5-difluorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66199984) has the molecular formula C13H8F2N2OS and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(2,5-difluorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66199984 |
| Molecular Formula | C13H8F2N2OS |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 5-(2,5-difluorophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2cc(F)ccc2F)c1-c1cccs1 |
| InChI | InChI=1S/C13H8F2N2OS/c14-7-3-4-9(15)8(6-7)12-11(13(16)17-18-12)10-2-1-5-19-10/h1-6H,(H2,16,17) |
| InChIKey | VBRGFTZQINHQMU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |