C13H9N3O3S — CID 66197989
5-(2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine (PubChem CID 66197989) has the molecular formula C13H9N3O3S and a molecular weight of 287.30 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine.
| Compound Name | 5-(2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66197989 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-(2-nitrophenyl)-4-thiophen-2-yl-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccccc2[N+](=O)[O-])c1-c1cccs1 |
| InChI | InChI=1S/C13H9N3O3S/c14-13-11(10-6-3-7-20-10)12(19-15-13)8-4-1-2-5-9(8)16(17)18/h1-7H,(H2,14,15) |
| InChIKey | UDRZRBLWORVLHR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|