C11H11FN2O — CID 81479051
5-(2-fluoro-3-methylphenyl)-4-methyl-1,2-oxazol-3-amine (PubChem CID 81479051) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-(2-fluoro-3-methylphenyl)-4-methyl-1,2-oxazol-3-amine.
| Compound Name | 5-(2-fluoro-3-methylphenyl)-4-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 81479051 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-(2-fluoro-3-methylphenyl)-4-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1cccc(-c2onc(N)c2C)c1F |
| InChI | InChI=1S/C11H11FN2O/c1-6-4-3-5-8(9(6)12)10-7(2)11(13)14-15-10/h3-5H,1-2H3,(H2,13,14) |
| InChIKey | XCGAPQSVDOXCRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |