C10H9ClN2O — CID 66198805
5-(2-chlorophenyl)-4-methyl-1,2-oxazol-3-amine (PubChem CID 66198805) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-4-methyl-1,2-oxazol-3-amine.
| Compound Name | 5-(2-chlorophenyl)-4-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66198805 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 5-(2-chlorophenyl)-4-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1c(N)noc1-c1ccccc1Cl |
| InChI | InChI=1S/C10H9ClN2O/c1-6-9(14-13-10(6)12)7-4-2-3-5-8(7)11/h2-5H,1H3,(H2,12,13) |
| InChIKey | VGYCDPSZOLSZGN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |