C15H10ClFN2O — CID 66206213
4-(2-chlorophenyl)-5-(2-fluorophenyl)-1,2-oxazol-3-amine (PubChem CID 66206213) has the molecular formula C15H10ClFN2O and a molecular weight of 288.71 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-(2-fluorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-chlorophenyl)-5-(2-fluorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66206213 |
| Molecular Formula | C15H10ClFN2O |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-(2-chlorophenyl)-5-(2-fluorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2ccccc2F)c1-c1ccccc1Cl |
| InChI | InChI=1S/C15H10ClFN2O/c16-11-7-3-1-5-9(11)13-14(20-19-15(13)18)10-6-2-4-8-12(10)17/h1-8H,(H2,18,19) |
| InChIKey | WBHQQIGZUFVNEW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |