C17H15ClN2O — CID 66207019
4-(2-chlorophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine (PubChem CID 66207019) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-chlorophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66207019 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 4-(2-chlorophenyl)-5-(3,5-dimethylphenyl)-1,2-oxazol-3-amine |
| SMILES | Cc1cc(C)cc(-c2onc(N)c2-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O/c1-10-7-11(2)9-12(8-10)16-15(17(19)20-21-16)13-5-3-4-6-14(13)18/h3-9H,1-2H3,(H2,19,20) |
| InChIKey | VIVXPLOTHXXGBY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |