C15H9Cl3N2O — CID 66205609
4-(2-chlorophenyl)-5-(2,6-dichlorophenyl)-1,2-oxazol-3-amine (PubChem CID 66205609) has the molecular formula C15H9Cl3N2O and a molecular weight of 339.61 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-(2,6-dichlorophenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-chlorophenyl)-5-(2,6-dichlorophenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 66205609 |
| Molecular Formula | C15H9Cl3N2O |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 4-(2-chlorophenyl)-5-(2,6-dichlorophenyl)-1,2-oxazol-3-amine |
| SMILES | Nc1noc(-c2c(Cl)cccc2Cl)c1-c1ccccc1Cl |
| InChI | InChI=1S/C15H9Cl3N2O/c16-9-5-2-1-4-8(9)12-14(21-20-15(12)19)13-10(17)6-3-7-11(13)18/h1-7H,(H2,19,20) |
| InChIKey | ATHHWYLEDXIDHX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |