About 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine
4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine (PubChem CID 87134636) has the molecular formula C15H12Cl2N4O2
and a molecular weight of 351.19 g/mol. Its IUPAC name is 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine |
| PubChem CID | 87134636 |
| Molecular Formula | C15H12Cl2N4O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine |
| SMILES | COc1ccccc1Oc1c(Cl)ncnc1Cl.c1cncnc1 |
| InChI | InChI=1S/C11H8Cl2N2O2.C4H4N2/c1-16-7-4-2-3-5-8(7)17-9-10(12)14-6-15-11(9)13;1-2-5-4-6-3-1/h2-6H,1H3;1-4H |
| InChIKey | SHRLDXCWYYXKDQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine?
The IUPAC name of 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine (CID 87134636) is 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine.
What is the SMILES notation for 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine?
The canonical SMILES for 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine is COc1ccccc1Oc1c(Cl)ncnc1Cl.c1cncnc1.
What is the InChIKey of 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine?
The InChIKey is SHRLDXCWYYXKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Cl2N2O2.C4H4N2/c1-16-7-4-2-3-5-8(7)17-9-10(12)14-6-15-11(9)13;1-2-5-4-6-3-1/h2-6H,1H3;1-4H.
What are the key properties of 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine?
4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine has a molecular weight of 351.19 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-5-(2-methoxyphenoxy)pyrimidine;pyrimidine is sourced from PubChem (CID 87134636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).