C20H14F4O4 — CID 1380018
1,2,4,5-tetrafluoro-3,6-bis(2-methoxyphenoxy)benzene (PubChem CID 1380018) has the molecular formula C20H14F4O4 and a molecular weight of 394.32 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis(2-methoxyphenoxy)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis(2-methoxyphenoxy)benzene |
|---|---|
| PubChem CID | 1380018 |
| Molecular Formula | C20H14F4O4 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis(2-methoxyphenoxy)benzene |
| SMILES | COc1ccccc1Oc1c(F)c(F)c(Oc2ccccc2OC)c(F)c1F |
| InChI | InChI=1S/C20H14F4O4/c1-25-11-7-3-5-9-13(11)27-19-15(21)17(23)20(18(24)16(19)22)28-14-10-6-4-8-12(14)26-2/h3-10H,1-2H3 |
| InChIKey | FUDIGUGQVGDUQP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|