C18H14Cl2F4N2O2 — CID 50944455
2-[4-(2-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline;dihydrochloride (PubChem CID 50944455) has the molecular formula C18H14Cl2F4N2O2 and a molecular weight of 437.22 g/mol. Its IUPAC name is 2-[4-(2-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline;dihydrochloride.
| Compound Name | 2-[4-(2-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline;dihydrochloride |
|---|---|
| PubChem CID | 50944455 |
| Molecular Formula | C18H14Cl2F4N2O2 |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-[4-(2-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1Oc1c(F)c(F)c(Oc2ccccc2N)c(F)c1F |
| InChI | InChI=1S/C18H12F4N2O2.2ClH/c19-13-15(21)18(26-12-8-4-2-6-10(12)24)16(22)14(20)17(13)25-11-7-3-1-5-9(11)23;;/h1-8H,23-24H2;2*1H |
| InChIKey | JXFUEUSZXTXDJE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|