C20H14F6N2O2 — CID 22058912
4-[2-(4-amino-2,3,5-trifluoro-6-methylphenoxy)phenoxy]-2,3,6-trifluoro-5-methylaniline (PubChem CID 22058912) has the molecular formula C20H14F6N2O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 4-[2-(4-amino-2,3,5-trifluoro-6-methylphenoxy)phenoxy]-2,3,6-trifluoro-5-methylaniline.
| Compound Name | 4-[2-(4-amino-2,3,5-trifluoro-6-methylphenoxy)phenoxy]-2,3,6-trifluoro-5-methylaniline |
|---|---|
| PubChem CID | 22058912 |
| Molecular Formula | C20H14F6N2O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 4-[2-(4-amino-2,3,5-trifluoro-6-methylphenoxy)phenoxy]-2,3,6-trifluoro-5-methylaniline |
| SMILES | Cc1c(F)c(N)c(F)c(F)c1Oc1ccccc1Oc1c(C)c(F)c(N)c(F)c1F |
| InChI | InChI=1S/C20H14F6N2O2/c1-7-11(21)17(27)13(23)15(25)19(7)29-9-5-3-4-6-10(9)30-20-8(2)12(22)18(28)14(24)16(20)26/h3-6H,27-28H2,1-2H3 |
| InChIKey | BTEACPPRRHSCIN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|