C13H11F2NO2 — CID 115507261
2,4-difluoro-6-(2-methoxyphenoxy)aniline (PubChem CID 115507261) has the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. Its IUPAC name is 2,4-difluoro-6-(2-methoxyphenoxy)aniline.
| Compound Name | 2,4-difluoro-6-(2-methoxyphenoxy)aniline |
|---|---|
| PubChem CID | 115507261 |
| Molecular Formula | C13H11F2NO2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2,4-difluoro-6-(2-methoxyphenoxy)aniline |
| SMILES | COc1ccccc1Oc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C13H11F2NO2/c1-17-10-4-2-3-5-11(10)18-12-7-8(14)6-9(15)13(12)16/h2-7H,16H2,1H3 |
| InChIKey | PLRICEFYYPOVEP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|