C13H11F2NO2 — CID 113325423
[2-(2-amino-3,5-difluorophenoxy)phenyl]methanol (PubChem CID 113325423) has the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. Its IUPAC name is [2-(2-amino-3,5-difluorophenoxy)phenyl]methanol.
| Compound Name | [2-(2-amino-3,5-difluorophenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 113325423 |
| Molecular Formula | C13H11F2NO2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | [2-(2-amino-3,5-difluorophenoxy)phenyl]methanol |
| SMILES | Nc1c(F)cc(F)cc1Oc1ccccc1CO |
| InChI | InChI=1S/C13H11F2NO2/c14-9-5-10(15)13(16)12(6-9)18-11-4-2-1-3-8(11)7-17/h1-6,17H,7,16H2 |
| InChIKey | HXERJUVSRCKDMQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|